C19H29NO6 — CID 2935433
4-[3-(3-ethylphenoxy)propyl]-2,6-dimethylmorpholine;oxalic acid (PubChem CID 2935433) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is 4-[3-(3-ethylphenoxy)propyl]-2,6-dimethylmorpholine;oxalic acid.
| Compound Name | 4-[3-(3-ethylphenoxy)propyl]-2,6-dimethylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 2935433 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-[3-(3-ethylphenoxy)propyl]-2,6-dimethylmorpholine;oxalic acid |
| SMILES | CCc1cccc(OCCCN2CC(C)OC(C)C2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H27NO2.C2H2O4/c1-4-16-7-5-8-17(11-16)19-10-6-9-18-12-14(2)20-15(3)13-18;3-1(4)2(5)6/h5,7-8,11,14-15H,4,6,9-10,12-13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SGUXPCQQHBQURS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|