C14H20ClNO3 — CID 102935770
[4-[2-(3-chlorophenoxy)ethyl]-6-methylmorpholin-2-yl]methanol (PubChem CID 102935770) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is [4-[2-(3-chlorophenoxy)ethyl]-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[2-(3-chlorophenoxy)ethyl]-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102935770 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [4-[2-(3-chlorophenoxy)ethyl]-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(CCOc2cccc(Cl)c2)CC(CO)O1 |
| InChI | InChI=1S/C14H20ClNO3/c1-11-8-16(9-14(10-17)19-11)5-6-18-13-4-2-3-12(15)7-13/h2-4,7,11,14,17H,5-6,8-10H2,1H3 |
| InChIKey | GXSCVWUFQYUKIQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |