C19H31NO2 — CID 2934238
1-[2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine (PubChem CID 2934238) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 1-[2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine.
| Compound Name | 1-[2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 2934238 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 1-[2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine |
| SMILES | Cc1cccc(OCCOCCN2CC(C)CC(C)C2)c1C |
| InChI | InChI=1S/C19H31NO2/c1-15-12-16(2)14-20(13-15)8-9-21-10-11-22-19-7-5-6-17(3)18(19)4/h5-7,15-16H,8-14H2,1-4H3 |
| InChIKey | RVGDAKXKLNSVBC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|