C19H31NO — CID 2181589
(3R,5S)-3,5-dimethyl-1-[3-(2,3,5-trimethylphenoxy)propyl]piperidine (PubChem CID 2181589) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-1-[3-(2,3,5-trimethylphenoxy)propyl]piperidine.
| Compound Name | (3R,5S)-3,5-dimethyl-1-[3-(2,3,5-trimethylphenoxy)propyl]piperidine |
|---|---|
| PubChem CID | 2181589 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-1-[3-(2,3,5-trimethylphenoxy)propyl]piperidine |
| SMILES | Cc1cc(C)c(C)c(OCCCN2C[C@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H31NO/c1-14-10-17(4)18(5)19(11-14)21-8-6-7-20-12-15(2)9-16(3)13-20/h10-11,15-16H,6-9,12-13H2,1-5H3/t15-,16+ |
| InChIKey | DVZQUIYMGRAYFF-IYBDPMFKSA-N |
| XLogP | 4.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|