C23H31NO — CID 11979093
(3S,5S)-3,5-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine (PubChem CID 11979093) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 11979093 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine |
| SMILES | Cc1ccc(-c2ccc(OCCCN3C[C@@H](C)C[C@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-18-5-7-21(8-6-18)22-9-11-23(12-10-22)25-14-4-13-24-16-19(2)15-20(3)17-24/h5-12,19-20H,4,13-17H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | JGWDSUVLGQNODW-PMACEKPBSA-N |
| XLogP | 5.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|