C25H36N2O9 — CID 162312541
(3R,5R)-3,5-dimethyl-1-[3-[4-(2,3,4,5-tetrahydropyridin-6-yl)phenoxy]propyl]piperidine;oxalic acid (PubChem CID 162312541) has the molecular formula C25H36N2O9 and a molecular weight of 508.57 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-1-[3-[4-(2,3,4,5-tetrahydropyridin-6-yl)phenoxy]propyl]piperidine;oxalic acid.
| Compound Name | (3R,5R)-3,5-dimethyl-1-[3-[4-(2,3,4,5-tetrahydropyridin-6-yl)phenoxy]propyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 162312541 |
| Molecular Formula | C25H36N2O9 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-1-[3-[4-(2,3,4,5-tetrahydropyridin-6-yl)phenoxy]propyl]piperidine;oxalic acid |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCOc2ccc(C3=NCCCC3)cc2)C1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H32N2O.2C2H2O4/c1-17-14-18(2)16-23(15-17)12-5-13-24-20-9-7-19(8-10-20)21-6-3-4-11-22-21;2*3-1(4)2(5)6/h7-10,17-18H,3-6,11-16H2,1-2H3;2*(H,3,4)(H,5,6)/t17-,18-;;/m1../s1 |
| InChIKey | UNFJOIWMUHIZBS-RKDOVGOJSA-N |
| XLogP | 2.72 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|