C19H28N2O — CID 11978855
6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine (PubChem CID 11978855) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 11978855 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine |
| SMILES | c1cc(C2=NCCCC2)ccc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C19H28N2O/c1-4-13-21(14-5-1)15-6-16-22-18-10-8-17(9-11-18)19-7-2-3-12-20-19/h8-11H,1-7,12-16H2 |
| InChIKey | KWETVAOOZWXCFI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|