C19H28N2O — CID 69137569
4-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,2,3,6-tetrahydropyridine (PubChem CID 69137569) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 69137569 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-[4-(3-piperidin-1-ylpropoxy)phenyl]-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(c2ccc(OCCCN3CCCCC3)cc2)CCNC1 |
| InChI | InChI=1S/C19H28N2O/c1-2-13-21(14-3-1)15-4-16-22-19-7-5-17(6-8-19)18-9-11-20-12-10-18/h5-9,20H,1-4,10-16H2 |
| InChIKey | XPRAOGZNTJMGOI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|