C21H33N3O — CID 141200350
6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-propan-2-yl-4,5-dihydro-3H-pyridazine (PubChem CID 141200350) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-propan-2-yl-4,5-dihydro-3H-pyridazine.
| Compound Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-propan-2-yl-4,5-dihydro-3H-pyridazine |
|---|---|
| PubChem CID | 141200350 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-propan-2-yl-4,5-dihydro-3H-pyridazine |
| SMILES | CC(C)N1CCCC(c2ccc(OCCCN3CCCCC3)cc2)=N1 |
| InChI | InChI=1S/C21H33N3O/c1-18(2)24-16-6-8-21(22-24)19-9-11-20(12-10-19)25-17-7-15-23-13-4-3-5-14-23/h9-12,18H,3-8,13-17H2,1-2H3 |
| InChIKey | BALMOAZRIFADRA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|