C23H32N2O9 — CID 23150757
oxalic acid;6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine (PubChem CID 23150757) has the molecular formula C23H32N2O9 and a molecular weight of 480.51 g/mol. Its IUPAC name is oxalic acid;6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine.
| Compound Name | oxalic acid;6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 23150757 |
| Molecular Formula | C23H32N2O9 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | oxalic acid;6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2,3,4,5-tetrahydropyridine |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.c1cc(C2=NCCCC2)ccc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C19H28N2O.2C2H2O4/c1-4-13-21(14-5-1)15-6-16-22-18-10-8-17(9-11-18)19-7-2-3-12-20-19;2*3-1(4)2(5)6/h8-11H,1-7,12-16H2;2*(H,3,4)(H,5,6) |
| InChIKey | GIODLTRAYOHMKE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|