C20H30N2O — CID 69108440
(5S)-1-[3-[4-(3,4-dihydro-2H-pyrrol-5-yl)phenoxy]propyl]-3,5-dimethylpiperidine (PubChem CID 69108440) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (5S)-1-[3-[4-(3,4-dihydro-2H-pyrrol-5-yl)phenoxy]propyl]-3,5-dimethylpiperidine.
| Compound Name | (5S)-1-[3-[4-(3,4-dihydro-2H-pyrrol-5-yl)phenoxy]propyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 69108440 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (5S)-1-[3-[4-(3,4-dihydro-2H-pyrrol-5-yl)phenoxy]propyl]-3,5-dimethylpiperidine |
| SMILES | CC1C[C@H](C)CN(CCCOc2ccc(C3=NCCC3)cc2)C1 |
| InChI | InChI=1S/C20H30N2O/c1-16-13-17(2)15-22(14-16)11-4-12-23-19-8-6-18(7-9-19)20-5-3-10-21-20/h6-9,16-17H,3-5,10-15H2,1-2H3/t16-,17?/m0/s1 |
| InChIKey | TXAZNXFBKASBOP-BHWOMJMDSA-N |
| XLogP | 4.02 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|