C17H26BrNO — CID 2184296
(3S,5S)-1-[3-(4-bromo-2-methylphenoxy)propyl]-3,5-dimethylpiperidine (PubChem CID 2184296) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is (3S,5S)-1-[3-(4-bromo-2-methylphenoxy)propyl]-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-[3-(4-bromo-2-methylphenoxy)propyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 2184296 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3S,5S)-1-[3-(4-bromo-2-methylphenoxy)propyl]-3,5-dimethylpiperidine |
| SMILES | Cc1cc(Br)ccc1OCCCN1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C17H26BrNO/c1-13-9-14(2)12-19(11-13)7-4-8-20-17-6-5-16(18)10-15(17)3/h5-6,10,13-14H,4,7-9,11-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | VWMVMSIKIGCBCD-KBPBESRZSA-N |
| XLogP | 4.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|