C17H25BrClNO — CID 7412942
(3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidine (PubChem CID 7412942) has the molecular formula C17H25BrClNO and a molecular weight of 374.75 g/mol. Its IUPAC name is (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 7412942 |
| Molecular Formula | C17H25BrClNO |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidine |
| SMILES | Cc1cc(Cl)c(OCCCN2C[C@@H](C)C[C@H](C)C2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrClNO/c1-12-8-15(18)17(16(19)9-12)21-6-4-5-20-10-13(2)7-14(3)11-20/h8-9,13-14H,4-7,10-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | YAEDUFNYVDYWSJ-KBPBESRZSA-N |
| XLogP | 5.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|