C17H26BrClNO+ — CID 7412941
(3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidin-1-ium (PubChem CID 7412941) has the molecular formula C17H26BrClNO+ and a molecular weight of 375.76 g/mol. Its IUPAC name is (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidin-1-ium.
| Compound Name | (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 7412941 |
| Molecular Formula | C17H26BrClNO+ |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (3S,5S)-1-[3-(2-bromo-6-chloro-4-methylphenoxy)propyl]-3,5-dimethylpiperidin-1-ium |
| SMILES | Cc1cc(Cl)c(OCCC[NH+]2C[C@@H](C)C[C@H](C)C2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrClNO/c1-12-8-15(18)17(16(19)9-12)21-6-4-5-20-10-13(2)7-14(3)11-20/h8-9,13-14H,4-7,10-11H2,1-3H3/p+1/t13-,14-/m0/s1 |
| InChIKey | YAEDUFNYVDYWSJ-KBPBESRZSA-O |
| XLogP | 3.74 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|