C18H29BrNO+ — CID 2183526
(3S)-1-[4-(2-bromo-4,6-dimethylphenoxy)butyl]-3-methylpiperidin-1-ium (PubChem CID 2183526) has the molecular formula C18H29BrNO+ and a molecular weight of 355.34 g/mol. Its IUPAC name is (3S)-1-[4-(2-bromo-4,6-dimethylphenoxy)butyl]-3-methylpiperidin-1-ium.
| Compound Name | (3S)-1-[4-(2-bromo-4,6-dimethylphenoxy)butyl]-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 2183526 |
| Molecular Formula | C18H29BrNO+ |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3S)-1-[4-(2-bromo-4,6-dimethylphenoxy)butyl]-3-methylpiperidin-1-ium |
| SMILES | Cc1cc(C)c(OCCCC[NH+]2CCC[C@H](C)C2)c(Br)c1 |
| InChI | InChI=1S/C18H28BrNO/c1-14-7-6-9-20(13-14)8-4-5-10-21-18-16(3)11-15(2)12-17(18)19/h11-12,14H,4-10,13H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | URQBIGPVUPCUIG-AWEZNQCLSA-O |
| XLogP | 3.54 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|