C17H26BrClNO2+ — CID 2183645
(3S)-1-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium (PubChem CID 2183645) has the molecular formula C17H26BrClNO2+ and a molecular weight of 391.76 g/mol. Its IUPAC name is (3S)-1-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium.
| Compound Name | (3S)-1-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 2183645 |
| Molecular Formula | C17H26BrClNO2+ |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3S)-1-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
| SMILES | Cc1cc(Cl)c(OCCOCC[NH+]2CCC[C@H](C)C2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrClNO2/c1-13-4-3-5-20(12-13)6-7-21-8-9-22-17-15(18)10-14(2)11-16(17)19/h10-11,13H,3-9,12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | FERNBCFSUGMRRK-ZDUSSCGKSA-O |
| XLogP | 3.12 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|