C13H19BrClNO2 — CID 2184438
2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]-N,N-dimethylethanamine (PubChem CID 2184438) has the molecular formula C13H19BrClNO2 and a molecular weight of 336.66 g/mol. Its IUPAC name is 2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 2184438 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]-N,N-dimethylethanamine |
| SMILES | Cc1cc(Cl)c(OCCOCCN(C)C)c(Br)c1 |
| InChI | InChI=1S/C13H19BrClNO2/c1-10-8-11(14)13(12(15)9-10)18-7-6-17-5-4-16(2)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | PMXZQWAUZZMYDS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|