C17H23BrClNO7 — CID 2924016
4-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]morpholine;oxalic acid (PubChem CID 2924016) has the molecular formula C17H23BrClNO7 and a molecular weight of 468.73 g/mol. Its IUPAC name is 4-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]morpholine;oxalic acid.
| Compound Name | 4-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 2924016 |
| Molecular Formula | C17H23BrClNO7 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 4-[2-[2-(2-bromo-6-chloro-4-methylphenoxy)ethoxy]ethyl]morpholine;oxalic acid |
| SMILES | Cc1cc(Cl)c(OCCOCCN2CCOCC2)c(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21BrClNO3.C2H2O4/c1-12-10-13(16)15(14(17)11-12)21-9-8-20-7-4-18-2-5-19-6-3-18;3-1(4)2(5)6/h10-11H,2-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OALCAIGRUJVRBC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|