C13H17BrClNO5 — CID 2935678
2-(2-bromo-6-chloro-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid (PubChem CID 2935678) has the molecular formula C13H17BrClNO5 and a molecular weight of 382.64 g/mol. Its IUPAC name is 2-(2-bromo-6-chloro-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-(2-bromo-6-chloro-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 2935678 |
| Molecular Formula | C13H17BrClNO5 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-(2-bromo-6-chloro-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
| SMILES | Cc1cc(Cl)c(OCCN(C)C)c(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H15BrClNO.C2H2O4/c1-8-6-9(12)11(10(13)7-8)15-5-4-14(2)3;3-1(4)2(5)6/h6-7H,4-5H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | RDUVKXBKTFXRAA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|