C13H18BrNO5 — CID 2934581
2-(2-bromo-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid (PubChem CID 2934581) has the molecular formula C13H18BrNO5 and a molecular weight of 348.19 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 2934581 |
| Molecular Formula | C13H18BrNO5 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
| SMILES | Cc1ccc(OCCN(C)C)c(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H16BrNO.C2H2O4/c1-9-4-5-11(10(12)8-9)14-7-6-13(2)3;3-1(4)2(5)6/h4-5,8H,6-7H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SECKTPIMEPNIOB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|