C15H23BrN2O5 — CID 2923994
N'-[4-(2-bromo-4-methylphenoxy)butyl]ethane-1,2-diamine;oxalic acid (PubChem CID 2923994) has the molecular formula C15H23BrN2O5 and a molecular weight of 391.26 g/mol. Its IUPAC name is N'-[4-(2-bromo-4-methylphenoxy)butyl]ethane-1,2-diamine;oxalic acid.
| Compound Name | N'-[4-(2-bromo-4-methylphenoxy)butyl]ethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 2923994 |
| Molecular Formula | C15H23BrN2O5 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N'-[4-(2-bromo-4-methylphenoxy)butyl]ethane-1,2-diamine;oxalic acid |
| SMILES | Cc1ccc(OCCCCNCCN)c(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H21BrN2O.C2H2O4/c1-11-4-5-13(12(14)10-11)17-9-3-2-7-16-8-6-15;3-1(4)2(5)6/h4-5,10,16H,2-3,6-9,15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | QFXTXJVFFCHKQA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|