C18H27NO6 — CID 2922603
2-[4-(4-methyl-2-prop-2-enylphenoxy)butylamino]ethanol;oxalic acid (PubChem CID 2922603) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[4-(4-methyl-2-prop-2-enylphenoxy)butylamino]ethanol;oxalic acid.
| Compound Name | 2-[4-(4-methyl-2-prop-2-enylphenoxy)butylamino]ethanol;oxalic acid |
|---|---|
| PubChem CID | 2922603 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-[4-(4-methyl-2-prop-2-enylphenoxy)butylamino]ethanol;oxalic acid |
| SMILES | C=CCc1cc(C)ccc1OCCCCNCCO.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H25NO2.C2H2O4/c1-3-6-15-13-14(2)7-8-16(15)19-12-5-4-9-17-10-11-18;3-1(4)2(5)6/h3,7-8,13,17-18H,1,4-6,9-12H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | DYTDJSRZALHOPT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|