C14H21NO6 — CID 2936004
2-(2-methoxy-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid (PubChem CID 2936004) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-(2-methoxy-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-(2-methoxy-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 2936004 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-(2-methoxy-4-methylphenoxy)-N,N-dimethylethanamine;oxalic acid |
| SMILES | COc1cc(C)ccc1OCCN(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19NO2.C2H2O4/c1-10-5-6-11(12(9-10)14-4)15-8-7-13(2)3;3-1(4)2(5)6/h5-6,9H,7-8H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | UJGQJCZONGQWFG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|