C11H17NO4S — CID 87290604
2-[2-(dimethylamino)ethoxy]-4-methylbenzenesulfonic acid (PubChem CID 87290604) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87290604 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(OCCN(C)C)c1 |
| InChI | InChI=1S/C11H17NO4S/c1-9-4-5-11(17(13,14)15)10(8-9)16-7-6-12(2)3/h4-5,8H,6-7H2,1-3H3,(H,13,14,15) |
| InChIKey | NDGYEJLAJSLAFI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|