2,4-dibutoxybenzenesulfonic acid

C14H22O5S — CID 23120668

IUPAC2,4-dibutoxybenzenesulfonic acid
SMILESCCCCOc1ccc(S(=O)(=O)O)c(OCCCC)c1
InChIInChI=1S/C14H22O5S/c1-3-5-9-18-12-7-8-14(20(15,16)17)13(11-12)19-10-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16,17)
InChIKeyLFWDFFBCXQJOJS-UHFFFAOYSA-N
MW302.39 g/mol
LogP3.29
Rot. Bonds9

About 2,4-dibutoxybenzenesulfonic acid

2,4-dibutoxybenzenesulfonic acid (PubChem CID 23120668) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is 2,4-dibutoxybenzenesulfonic acid.

Molecular Properties

Compound Name2,4-dibutoxybenzenesulfonic acid
PubChem CID23120668
Molecular FormulaC14H22O5S
Molecular Weight302.39 g/mol
Exact Mass302.12
IUPAC Name2,4-dibutoxybenzenesulfonic acid
SMILESCCCCOc1ccc(S(=O)(=O)O)c(OCCCC)c1
InChIInChI=1S/C14H22O5S/c1-3-5-9-18-12-7-8-14(20(15,16)17)13(11-12)19-10-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16,17)
InChIKeyLFWDFFBCXQJOJS-UHFFFAOYSA-N
XLogP3.29
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.39
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,4-dibutoxybenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dibutoxybenzenesulfonic acid?
The IUPAC name of 2,4-dibutoxybenzenesulfonic acid (CID 23120668) is 2,4-dibutoxybenzenesulfonic acid.
What is the SMILES notation for 2,4-dibutoxybenzenesulfonic acid?
The canonical SMILES for 2,4-dibutoxybenzenesulfonic acid is CCCCOc1ccc(S(=O)(=O)O)c(OCCCC)c1.
What is the InChIKey of 2,4-dibutoxybenzenesulfonic acid?
The InChIKey is LFWDFFBCXQJOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5S/c1-3-5-9-18-12-7-8-14(20(15,16)17)13(11-12)19-10-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16,17).
What are the key properties of 2,4-dibutoxybenzenesulfonic acid?
2,4-dibutoxybenzenesulfonic acid has a molecular weight of 302.39 g/mol, XLogP of 3.29, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibutoxybenzenesulfonic acid is sourced from PubChem (CID 23120668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).