C18H31NO4S — CID 67803858
2,4-diethoxy-N-octylbenzenesulfonamide (PubChem CID 67803858) has the molecular formula C18H31NO4S and a molecular weight of 357.52 g/mol. Its IUPAC name is 2,4-diethoxy-N-octylbenzenesulfonamide.
| Compound Name | 2,4-diethoxy-N-octylbenzenesulfonamide |
|---|---|
| PubChem CID | 67803858 |
| Molecular Formula | C18H31NO4S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2,4-diethoxy-N-octylbenzenesulfonamide |
| SMILES | CCCCCCCCNS(=O)(=O)c1ccc(OCC)cc1OCC |
| InChI | InChI=1S/C18H31NO4S/c1-4-7-8-9-10-11-14-19-24(20,21)18-13-12-16(22-5-2)15-17(18)23-6-3/h12-13,15,19H,4-11,14H2,1-3H3 |
| InChIKey | UGDMBMNGKYRPAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|