C20H27NO5S — CID 30365980
N-[2-(3,5-dimethylphenoxy)ethyl]-2,5-diethoxybenzenesulfonamide (PubChem CID 30365980) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2,5-diethoxybenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2,5-diethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 30365980 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2,5-diethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)NCCOc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C20H27NO5S/c1-5-24-17-7-8-19(25-6-2)20(14-17)27(22,23)21-9-10-26-18-12-15(3)11-16(4)13-18/h7-8,11-14,21H,5-6,9-10H2,1-4H3 |
| InChIKey | NLYWDUCADYKDDK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|