C25H29N5O7S — CID 121059309
N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2,5-diethoxybenzenesulfonamide (PubChem CID 121059309) has the molecular formula C25H29N5O7S and a molecular weight of 543.60 g/mol. Its IUPAC name is N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2,5-diethoxybenzenesulfonamide.
| Compound Name | N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2,5-diethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121059309 |
| Molecular Formula | C25H29N5O7S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-2,5-diethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)NCCOc2ccc3nnc(-c4ccc(OC)cc4OC)n3n2)c1 |
| InChI | InChI=1S/C25H29N5O7S/c1-5-35-18-8-10-20(36-6-2)22(16-18)38(31,32)26-13-14-37-24-12-11-23-27-28-25(30(23)29-24)19-9-7-17(33-3)15-21(19)34-4/h7-12,15-16,26H,5-6,13-14H2,1-4H3 |
| InChIKey | JMZVPNLNOCVQQY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|