C21H19ClN6O7S — CID 121059295
2-chloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-5-nitrobenzenesulfonamide (PubChem CID 121059295) has the molecular formula C21H19ClN6O7S and a molecular weight of 534.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121059295 |
| Molecular Formula | C21H19ClN6O7S |
| Molecular Weight | 534.94 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 2-chloro-N-[2-[[3-(2,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4cc([N+](=O)[O-])ccc4Cl)nn23)c(OC)c1 |
| InChI | InChI=1S/C21H19ClN6O7S/c1-33-14-4-5-15(17(12-14)34-2)21-25-24-19-7-8-20(26-27(19)21)35-10-9-23-36(31,32)18-11-13(28(29)30)3-6-16(18)22/h3-8,11-12,23H,9-10H2,1-2H3 |
| InChIKey | HKNUJFKCVBWHDR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|