C17H18ClF3N4O5S — CID 23151841
2-chloro-N-[3-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzenesulfonamide (PubChem CID 23151841) has the molecular formula C17H18ClF3N4O5S and a molecular weight of 482.87 g/mol. Its IUPAC name is 2-chloro-N-[3-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[3-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23151841 |
| Molecular Formula | C17H18ClF3N4O5S |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-chloro-N-[3-[[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzenesulfonamide |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(OCCCNS(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C17H18ClF3N4O5S/c1-24(2)15-8-11(17(19,20)21)9-16(23-15)30-7-3-6-22-31(28,29)14-10-12(25(26)27)4-5-13(14)18/h4-5,8-10,22H,3,6-7H2,1-2H3 |
| InChIKey | RPUVYYRMSUXQLW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|