C17H13ClF3N3O5S — CID 23151804
2-chloro-N-[3-[4-cyano-2-(trifluoromethyl)phenoxy]propyl]-5-nitrobenzenesulfonamide (PubChem CID 23151804) has the molecular formula C17H13ClF3N3O5S and a molecular weight of 463.82 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-cyano-2-(trifluoromethyl)phenoxy]propyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[3-[4-cyano-2-(trifluoromethyl)phenoxy]propyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23151804 |
| Molecular Formula | C17H13ClF3N3O5S |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 2-chloro-N-[3-[4-cyano-2-(trifluoromethyl)phenoxy]propyl]-5-nitrobenzenesulfonamide |
| SMILES | N#Cc1ccc(OCCCNS(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3N3O5S/c18-14-4-3-12(24(25)26)9-16(14)30(27,28)23-6-1-7-29-15-5-2-11(10-22)8-13(15)17(19,20)21/h2-5,8-9,23H,1,6-7H2 |
| InChIKey | IMKABPRLDNYWDS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|