C12H12F3NO3S — CID 115467864
4-(3-methylsulfonylpropoxy)-3-(trifluoromethyl)benzonitrile (PubChem CID 115467864) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-(3-methylsulfonylpropoxy)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-methylsulfonylpropoxy)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115467864 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-(3-methylsulfonylpropoxy)-3-(trifluoromethyl)benzonitrile |
| SMILES | CS(=O)(=O)CCCOc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3S/c1-20(17,18)6-2-5-19-11-4-3-9(8-16)7-10(11)12(13,14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | JXNCKINRKHJQBJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|