C14H10F3NOS — CID 115467860
4-(2-thiophen-3-ylethoxy)-3-(trifluoromethyl)benzonitrile (PubChem CID 115467860) has the molecular formula C14H10F3NOS and a molecular weight of 297.30 g/mol. Its IUPAC name is 4-(2-thiophen-3-ylethoxy)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(2-thiophen-3-ylethoxy)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115467860 |
| Molecular Formula | C14H10F3NOS |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-(2-thiophen-3-ylethoxy)-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OCCc2ccsc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NOS/c15-14(16,17)12-7-11(8-18)1-2-13(12)19-5-3-10-4-6-20-9-10/h1-2,4,6-7,9H,3,5H2 |
| InChIKey | DCWYPLLGNVPNHE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |