C14H11ClF3N3O5S — CID 23152088
2-chloro-5-nitro-N-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]propyl]benzenesulfonamide (PubChem CID 23152088) has the molecular formula C14H11ClF3N3O5S and a molecular weight of 425.77 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]propyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-nitro-N-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23152088 |
| Molecular Formula | C14H11ClF3N3O5S |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 2-chloro-5-nitro-N-[3-[(3,5,6-trifluoro-2-pyridinyl)oxy]propyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)NCCCOc2nc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C14H11ClF3N3O5S/c15-9-3-2-8(21(22)23)6-12(9)27(24,25)19-4-1-5-26-14-11(17)7-10(16)13(18)20-14/h2-3,6-7,19H,1,4-5H2 |
| InChIKey | NJQYBBGXPDRQCT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|