C16H14ClN3O4S3 — CID 23152123
N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-2-chloro-5-nitrobenzenesulfonamide (PubChem CID 23152123) has the molecular formula C16H14ClN3O4S3 and a molecular weight of 443.96 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-2-chloro-5-nitrobenzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-2-chloro-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23152123 |
| Molecular Formula | C16H14ClN3O4S3 |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-2-chloro-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)NCCCSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C16H14ClN3O4S3/c17-12-7-6-11(20(21)22)10-15(12)27(23,24)18-8-3-9-25-16-19-13-4-1-2-5-14(13)26-16/h1-2,4-7,10,18H,3,8-9H2 |
| InChIKey | HELHVNOFCRQQFG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|