C13H16N2S2 — CID 60648664
N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]cyclopropanamine (PubChem CID 60648664) has the molecular formula C13H16N2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]cyclopropanamine.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 60648664 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]cyclopropanamine |
| SMILES | c1ccc2sc(SCCCNC3CC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S2/c1-2-5-12-11(4-1)15-13(17-12)16-9-3-8-14-10-6-7-10/h1-2,4-5,10,14H,3,6-9H2 |
| InChIKey | PAOQTFWLXBSQSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|