C21H24N4O2S2 — CID 52946516
1-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-(3-phenylpropylcarbamoyl)urea (PubChem CID 52946516) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-(3-phenylpropylcarbamoyl)urea.
| Compound Name | 1-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-(3-phenylpropylcarbamoyl)urea |
|---|---|
| PubChem CID | 52946516 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-(3-phenylpropylcarbamoyl)urea |
| SMILES | O=C(NCCCSc1nc2ccccc2s1)NC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O2S2/c26-19(22-13-6-10-16-8-2-1-3-9-16)25-20(27)23-14-7-15-28-21-24-17-11-4-5-12-18(17)29-21/h1-5,8-9,11-12H,6-7,10,13-15H2,(H3,22,23,25,26,27) |
| InChIKey | SRFZHXDEBNAWPF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|