C15H20N2O2S2 — CID 103919016
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-hydroxyhexyl)acetamide (PubChem CID 103919016) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-hydroxyhexyl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-hydroxyhexyl)acetamide |
|---|---|
| PubChem CID | 103919016 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(6-hydroxyhexyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NCCCCCCO |
| InChI | InChI=1S/C15H20N2O2S2/c18-10-6-2-1-5-9-16-14(19)11-20-15-17-12-7-3-4-8-13(12)21-15/h3-4,7-8,18H,1-2,5-6,9-11H2,(H,16,19) |
| InChIKey | DFWORYIOEZDACY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|