C21H30N4O3S2 — CID 55866145
tert-butyl 4-[3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 55866145) has the molecular formula C21H30N4O3S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is tert-butyl 4-[3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55866145 |
| Molecular Formula | C21H30N4O3S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | tert-butyl 4-[3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)CSc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H30N4O3S2/c1-21(2,3)28-20(27)25-13-11-24(12-14-25)10-6-9-22-18(26)15-29-19-23-16-7-4-5-8-17(16)30-19/h4-5,7-8H,6,9-15H2,1-3H3,(H,22,26) |
| InChIKey | GGAFNMVVPHGIQG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|