C21H30N4O4S — CID 60518312
tert-butyl 4-[3-[[2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 60518312) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[[2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 60518312 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | tert-butyl 4-[3-[[2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | Cc1sc(-c2ccco2)nc1C(=O)NCCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30N4O4S/c1-15-17(23-19(30-15)16-7-5-14-28-16)18(26)22-8-6-9-24-10-12-25(13-11-24)20(27)29-21(2,3)4/h5,7,14H,6,8-13H2,1-4H3,(H,22,26) |
| InChIKey | XEIHOASHZNQECM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|