C20H31N3O4 — CID 47038372
tert-butyl 4-[3-[(4-methoxybenzoyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 47038372) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl 4-[3-[(4-methoxybenzoyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(4-methoxybenzoyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 47038372 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl 4-[3-[(4-methoxybenzoyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(C(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-20(2,3)27-19(25)23-14-12-22(13-15-23)11-5-10-21-18(24)16-6-8-17(26-4)9-7-16/h6-9H,5,10-15H2,1-4H3,(H,21,24) |
| InChIKey | NTQNQYWBUXKDSP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|