C22H30N4O4 — CID 55912296
tert-butyl 4-[3-[[4-(1,3-oxazol-5-yl)benzoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 55912296) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[[4-(1,3-oxazol-5-yl)benzoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[4-(1,3-oxazol-5-yl)benzoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55912296 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl 4-[3-[[4-(1,3-oxazol-5-yl)benzoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)c2ccc(-c3cnco3)cc2)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-22(2,3)30-21(28)26-13-11-25(12-14-26)10-4-9-24-20(27)18-7-5-17(6-8-18)19-15-23-16-29-19/h5-8,15-16H,4,9-14H2,1-3H3,(H,24,27) |
| InChIKey | SKBKHZZQJHRXDT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|