C22H29ClN4O4 — CID 55867832
tert-butyl 4-[3-[[5-(3-chlorophenyl)-1,2-oxazole-3-carbonyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 55867832) has the molecular formula C22H29ClN4O4 and a molecular weight of 448.95 g/mol. Its IUPAC name is tert-butyl 4-[3-[[5-(3-chlorophenyl)-1,2-oxazole-3-carbonyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[5-(3-chlorophenyl)-1,2-oxazole-3-carbonyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55867832 |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl 4-[3-[[5-(3-chlorophenyl)-1,2-oxazole-3-carbonyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)c2cc(-c3cccc(Cl)c3)on2)CC1 |
| InChI | InChI=1S/C22H29ClN4O4/c1-22(2,3)30-21(29)27-12-10-26(11-13-27)9-5-8-24-20(28)18-15-19(31-25-18)16-6-4-7-17(23)14-16/h4,6-7,14-15H,5,8-13H2,1-3H3,(H,24,28) |
| InChIKey | IKWDJKUWJVEWQN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|