C14H18N2O2S2 — CID 107299972
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxypentyl)acetamide (PubChem CID 107299972) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxypentyl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107299972 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxypentyl)acetamide |
| SMILES | CC(O)CCCNC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-10(17)5-4-8-15-13(18)9-19-14-16-11-6-2-3-7-12(11)20-14/h2-3,6-7,10,17H,4-5,8-9H2,1H3,(H,15,18) |
| InChIKey | OWGSUKJVTRJVKD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|