C17H17N3OS2 — CID 9113227
4-(1,3-benzothiazol-2-ylsulfanyl)-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 9113227) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 9113227 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)NCc1ccncc1 |
| InChI | InChI=1S/C17H17N3OS2/c21-16(19-12-13-7-9-18-10-8-13)6-3-11-22-17-20-14-4-1-2-5-15(14)23-17/h1-2,4-5,7-10H,3,6,11-12H2,(H,19,21) |
| InChIKey | NOXDGEXTUPRIII-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|