C19H20N4O3S2 — CID 9308606
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-nitroanilino)ethyl]butanamide (PubChem CID 9308606) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-nitroanilino)ethyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-nitroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 9308606 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(4-nitroanilino)ethyl]butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c24-18(21-12-11-20-14-7-9-15(10-8-14)23(25)26)6-3-13-27-19-22-16-4-1-2-5-17(16)28-19/h1-2,4-5,7-10,20H,3,6,11-13H2,(H,21,24) |
| InChIKey | NCLKALSPYOZJED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|