C18H16N4OS2 — CID 2102629
N-(1H-benzimidazol-2-yl)-4-(1,3-benzothiazol-2-ylsulfanyl)butanamide (PubChem CID 2102629) has the molecular formula C18H16N4OS2 and a molecular weight of 368.49 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-4-(1,3-benzothiazol-2-ylsulfanyl)butanamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-4-(1,3-benzothiazol-2-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 2102629 |
| Molecular Formula | C18H16N4OS2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-4-(1,3-benzothiazol-2-ylsulfanyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H16N4OS2/c23-16(22-17-19-12-6-1-2-7-13(12)20-17)10-5-11-24-18-21-14-8-3-4-9-15(14)25-18/h1-4,6-9H,5,10-11H2,(H2,19,20,22,23) |
| InChIKey | NSYIRXOHAGJDOB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|