C11H10N2O4S2 — CID 5177275
4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]butanoic acid (PubChem CID 5177275) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]butanoic acid.
| Compound Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 5177275 |
| Molecular Formula | C11H10N2O4S2 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C11H10N2O4S2/c14-10(15)2-1-5-18-11-12-8-4-3-7(13(16)17)6-9(8)19-11/h3-4,6H,1-2,5H2,(H,14,15) |
| InChIKey | WMVWVHRAIXKTED-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|