C10H6N6O4S2 — CID 57019863
2-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-5-yl]acetic acid (PubChem CID 57019863) has the molecular formula C10H6N6O4S2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-5-yl]acetic acid.
| Compound Name | 2-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 57019863 |
| Molecular Formula | C10H6N6O4S2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 2-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]tetrazol-5-yl]acetic acid |
| SMILES | O=C(O)CC1(Sc2nc3ccc([N+](=O)[O-])cc3s2)N=NN=N1 |
| InChI | InChI=1S/C10H6N6O4S2/c17-8(18)4-10(12-14-15-13-10)22-9-11-6-2-1-5(16(19)20)3-7(6)21-9/h1-3H,4H2,(H,17,18) |
| InChIKey | ISNLVBBUFITYDP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|