C13H13N3O6S — CID 2852708
3-[2-carboxyethyl-(6-nitro-1,3-benzothiazol-2-yl)amino]propanoic acid (PubChem CID 2852708) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-[2-carboxyethyl-(6-nitro-1,3-benzothiazol-2-yl)amino]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-(6-nitro-1,3-benzothiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 2852708 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-[2-carboxyethyl-(6-nitro-1,3-benzothiazol-2-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(=O)O)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H13N3O6S/c17-11(18)3-5-15(6-4-12(19)20)13-14-9-2-1-8(16(21)22)7-10(9)23-13/h1-2,7H,3-6H2,(H,17,18)(H,19,20) |
| InChIKey | WXDDHKPJCLVUES-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|